About [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate
[2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate (PubChem CID 54375017) has the molecular formula C35H49NO3
and a molecular weight of 531.78 g/mol. Its IUPAC name is [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate.
Molecular Properties
| Compound Name | [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate |
| PubChem CID | 54375017 |
| Molecular Formula | C35H49NO3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCCC1CCC(CCc2ccc(OC(=O)c3ccc(OCCCCCC)cc3)c(C#N)c2)CC1 |
| InChI | InChI=1S/C35H49NO3/c1-3-5-7-9-10-12-28-13-15-29(16-14-28)17-18-30-19-24-34(32(26-30)27-36)39-35(37)31-20-22-33(23-21-31)38-25-11-8-6-4-2/h19-24,26,28-29H,3-18,25H2,1-2H3 |
| InChIKey | UVWJIVYJTIUKJO-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate?
The IUPAC name of [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate (CID 54375017) is [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate.
What is the SMILES notation for [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate?
The canonical SMILES for [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate is CCCCCCCC1CCC(CCc2ccc(OC(=O)c3ccc(OCCCCCC)cc3)c(C#N)c2)CC1.
What is the InChIKey of [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate?
The InChIKey is UVWJIVYJTIUKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H49NO3/c1-3-5-7-9-10-12-28-13-15-29(16-14-28)17-18-30-19-24-34(32(26-30)27-36)39-35(37)31-20-22-33(23-21-31)38-25-11-8-6-4-2/h19-24,26,28-29H,3-18,25H2,1-2H3.
What are the key properties of [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate?
[2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate has a molecular weight of 531.78 g/mol, XLogP of 9.84, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-4-[2-(4-heptylcyclohexyl)ethyl]phenyl] 4-hexoxybenzoate is sourced from PubChem (CID 54375017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).