C17H31BO4 — CID 57283275
4-(5-heptyl-1,3,2-dioxaborinan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 57283275) has the molecular formula C17H31BO4 and a molecular weight of 310.24 g/mol. Its IUPAC name is 4-(5-heptyl-1,3,2-dioxaborinan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(5-heptyl-1,3,2-dioxaborinan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57283275 |
| Molecular Formula | C17H31BO4 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 4-(5-heptyl-1,3,2-dioxaborinan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCC1COB(C2CCC(C(=O)O)CC2)OC1 |
| InChI | InChI=1S/C17H31BO4/c1-2-3-4-5-6-7-14-12-21-18(22-13-14)16-10-8-15(9-11-16)17(19)20/h14-16H,2-13H2,1H3,(H,19,20) |
| InChIKey | YJTFEBVKSMWKQW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|