C26H44F2O3 — CID 20599930
5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-(4-heptoxycyclohexyl)-1,3-dioxane (PubChem CID 20599930) has the molecular formula C26H44F2O3 and a molecular weight of 442.63 g/mol. Its IUPAC name is 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-(4-heptoxycyclohexyl)-1,3-dioxane.
| Compound Name | 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-(4-heptoxycyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599930 |
| Molecular Formula | C26H44F2O3 |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-(4-heptoxycyclohexyl)-1,3-dioxane |
| SMILES | CCCCCCCOC1CCC(C2OCC(C3CCC(CC=C(F)F)CC3)CO2)CC1 |
| InChI | InChI=1S/C26H44F2O3/c1-2-3-4-5-6-17-29-24-14-12-22(13-15-24)26-30-18-23(19-31-26)21-10-7-20(8-11-21)9-16-25(27)28/h16,20-24,26H,2-15,17-19H2,1H3 |
| InChIKey | SVSAHAQRXZKXKM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|