C18H28F2O2 — CID 20599796
4-[3-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]oxypropyl]cyclohexan-1-one (PubChem CID 20599796) has the molecular formula C18H28F2O2 and a molecular weight of 314.42 g/mol. Its IUPAC name is 4-[3-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]oxypropyl]cyclohexan-1-one.
| Compound Name | 4-[3-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]oxypropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 20599796 |
| Molecular Formula | C18H28F2O2 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-[3-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]oxypropyl]cyclohexan-1-one |
| SMILES | O=C1CCC(CCCOC2CCC(CC=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C18H28F2O2/c19-18(20)12-7-15-5-10-17(11-6-15)22-13-1-2-14-3-8-16(21)9-4-14/h12,14-15,17H,1-11,13H2 |
| InChIKey | DSUQUQYLEIPXBP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|