C23H36F2O2 — CID 20599798
4-[3-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]propoxy]cyclohexan-1-one (PubChem CID 20599798) has the molecular formula C23H36F2O2 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-[3-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]propoxy]cyclohexan-1-one.
| Compound Name | 4-[3-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]propoxy]cyclohexan-1-one |
|---|---|
| PubChem CID | 20599798 |
| Molecular Formula | C23H36F2O2 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 4-[3-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]propoxy]cyclohexan-1-one |
| SMILES | O=C1CCC(OCCCC2CCC(C3CCC(C=C(F)F)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H36F2O2/c24-23(25)16-18-5-9-20(10-6-18)19-7-3-17(4-8-19)2-1-15-27-22-13-11-21(26)12-14-22/h16-20,22H,1-15H2 |
| InChIKey | ZWVLZGYUOVCCLB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|