C33H54F2O2 — CID 20599940
5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[3-[4-[(E)-pent-3-enyl]cyclohexyl]oxypropyl]oxane (PubChem CID 20599940) has the molecular formula C33H54F2O2 and a molecular weight of 520.79 g/mol. Its IUPAC name is 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[3-[4-[(E)-pent-3-enyl]cyclohexyl]oxypropyl]oxane.
| Compound Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[3-[4-[(E)-pent-3-enyl]cyclohexyl]oxypropyl]oxane |
|---|---|
| PubChem CID | 20599940 |
| Molecular Formula | C33H54F2O2 |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[3-[4-[(E)-pent-3-enyl]cyclohexyl]oxypropyl]oxane |
| SMILES | C/C=C/CCC1CCC(OCCCC2CCC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)CO2)CC1 |
| InChI | InChI=1S/C33H54F2O2/c1-2-3-4-6-25-10-19-32(20-11-25)36-22-5-7-31-21-18-30(24-37-31)29-16-14-28(15-17-29)27-12-8-26(9-13-27)23-33(34)35/h2-3,23,25-32H,4-22,24H2,1H3/b3-2+ |
| InChIKey | MSGVNJRLLMEIJI-NSCUHMNNSA-N |
| XLogP | 9.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|