C19H30F2O2 — CID 20600013
5-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-2-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 20600013) has the molecular formula C19H30F2O2 and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-2-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 5-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-2-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20600013 |
| Molecular Formula | C19H30F2O2 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 5-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-2-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1OCC(C2CCC(CCC=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C19H30F2O2/c1-2-3-4-8-19-22-13-17(14-23-19)16-11-9-15(10-12-16)6-5-7-18(20)21/h2-3,7,15-17,19H,4-6,8-14H2,1H3/b3-2+ |
| InChIKey | ZOGBURJKPQYVMQ-NSCUHMNNSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|