About 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane
2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane (PubChem CID 20599519) has the molecular formula C16H26F2O2
and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane |
| PubChem CID | 20599519 |
| Molecular Formula | C16H26F2O2 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane |
| SMILES | FC(F)=CCCC1CCC(CCC2OCCCO2)CC1 |
| InChI | InChI=1S/C16H26F2O2/c17-15(18)4-1-3-13-5-7-14(8-6-13)9-10-16-19-11-2-12-20-16/h4,13-14,16H,1-3,5-12H2 |
| InChIKey | RDOBOSCBKNECKZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane?
The IUPAC name of 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane (CID 20599519) is 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane is FC(F)=CCCC1CCC(CCC2OCCCO2)CC1.
What is the InChIKey of 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane?
The InChIKey is RDOBOSCBKNECKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F2O2/c17-15(18)4-1-3-13-5-7-14(8-6-13)9-10-16-19-11-2-12-20-16/h4,13-14,16H,1-3,5-12H2.
What are the key properties of 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane?
2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane has a molecular weight of 288.38 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-1,3-dioxane is sourced from PubChem (CID 20599519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).