About 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane
2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane (PubChem CID 20599462) has the molecular formula C22H34F2O2
and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane |
| PubChem CID | 20599462 |
| Molecular Formula | C22H34F2O2 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CC1CCC(CCC2CCC(C3COC(C=C(F)F)OC3)CC2)CC1 |
| InChI | InChI=1S/C22H34F2O2/c1-2-16-3-5-17(6-4-16)7-8-18-9-11-19(12-10-18)20-14-25-22(26-15-20)13-21(23)24/h2,13,16-20,22H,1,3-12,14-15H2 |
| InChIKey | MNJBHXVHADJNHC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane?
The IUPAC name of 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane (CID 20599462) is 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane.
What is the SMILES notation for 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane?
The canonical SMILES for 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane is C=CC1CCC(CCC2CCC(C3COC(C=C(F)F)OC3)CC2)CC1.
What is the InChIKey of 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane?
The InChIKey is MNJBHXVHADJNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34F2O2/c1-2-16-3-5-17(6-4-16)7-8-18-9-11-19(12-10-18)20-14-25-22(26-15-20)13-21(23)24/h2,13,16-20,22H,1,3-12,14-15H2.
What are the key properties of 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane?
2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane has a molecular weight of 368.51 g/mol, XLogP of 6.33, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane is sourced from PubChem (CID 20599462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).