C22H34F2O2 — CID 20599462
2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane (PubChem CID 20599462) has the molecular formula C22H34F2O2 and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599462 |
| Molecular Formula | C22H34F2O2 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-ethenylcyclohexyl)ethyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CC1CCC(CCC2CCC(C3COC(C=C(F)F)OC3)CC2)CC1 |
| InChI | InChI=1S/C22H34F2O2/c1-2-16-3-5-17(6-4-16)7-8-18-9-11-19(12-10-18)20-14-25-22(26-15-20)13-21(23)24/h2,13,16-20,22H,1,3-12,14-15H2 |
| InChIKey | MNJBHXVHADJNHC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|