C17H28F2O2 — CID 20599477
2-(2,2-difluoroethenyl)-5-(4-pentylcyclohexyl)-1,3-dioxane (PubChem CID 20599477) has the molecular formula C17H28F2O2 and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-(4-pentylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-(4-pentylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599477 |
| Molecular Formula | C17H28F2O2 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-(4-pentylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2COC(C=C(F)F)OC2)CC1 |
| InChI | InChI=1S/C17H28F2O2/c1-2-3-4-5-13-6-8-14(9-7-13)15-11-20-17(21-12-15)10-16(18)19/h10,13-15,17H,2-9,11-12H2,1H3 |
| InChIKey | LTKWXOOVPIJSBZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|