C17H26F2O2 — CID 20599486
2-[2-[4-(2,2-difluoroethenyl)cyclohexyl]ethyl]-5-[(E)-prop-1-enyl]-1,3-dioxane (PubChem CID 20599486) has the molecular formula C17H26F2O2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 2-[2-[4-(2,2-difluoroethenyl)cyclohexyl]ethyl]-5-[(E)-prop-1-enyl]-1,3-dioxane.
| Compound Name | 2-[2-[4-(2,2-difluoroethenyl)cyclohexyl]ethyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599486 |
| Molecular Formula | C17H26F2O2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-[2-[4-(2,2-difluoroethenyl)cyclohexyl]ethyl]-5-[(E)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(CCC2CCC(C=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C17H26F2O2/c1-2-3-15-11-20-17(21-12-15)9-8-13-4-6-14(7-5-13)10-16(18)19/h2-3,10,13-15,17H,4-9,11-12H2,1H3/b3-2+ |
| InChIKey | LOYYOHARCNKMNI-NSCUHMNNSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|