C23H38F2O4 — CID 20599480
2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-heptyl-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 20599480) has the molecular formula C23H38F2O4 and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-heptyl-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-heptyl-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599480 |
| Molecular Formula | C23H38F2O4 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-heptyl-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCCCCCC1COC(C2COC(C3CCC(C=C(F)F)CC3)OC2)OC1 |
| InChI | InChI=1S/C23H38F2O4/c1-2-3-4-5-6-7-18-13-26-23(27-14-18)20-15-28-22(29-16-20)19-10-8-17(9-11-19)12-21(24)25/h12,17-20,22-23H,2-11,13-16H2,1H3 |
| InChIKey | XMSIXCWFPMFORM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|