C18H30F2O2 — CID 20599934
5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-pentyl-1,3-dioxane (PubChem CID 20599934) has the molecular formula C18H30F2O2 and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-pentyl-1,3-dioxane.
| Compound Name | 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 20599934 |
| Molecular Formula | C18H30F2O2 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 5-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]-2-pentyl-1,3-dioxane |
| SMILES | CCCCCC1OCC(C2CCC(CC=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C18H30F2O2/c1-2-3-4-5-18-21-12-16(13-22-18)15-9-6-14(7-10-15)8-11-17(19)20/h11,14-16,18H,2-10,12-13H2,1H3 |
| InChIKey | MSSHWKZRXRBEPS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|