C30H48F2O — CID 20599968
5-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane (PubChem CID 20599968) has the molecular formula C30H48F2O and a molecular weight of 462.71 g/mol. Its IUPAC name is 5-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane.
| Compound Name | 5-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
|---|---|
| PubChem CID | 20599968 |
| Molecular Formula | C30H48F2O |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | 5-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)CC2)CO1 |
| InChI | InChI=1S/C30H48F2O/c1-2-3-4-5-29-19-18-28(21-33-29)27-16-14-26(15-17-27)25-12-10-24(11-13-25)23-8-6-22(7-9-23)20-30(31)32/h2-3,20,22-29H,4-19,21H2,1H3/b3-2+ |
| InChIKey | AZBHJRIJRRYAOR-NSCUHMNNSA-N |
| XLogP | 9.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|