C30H48F2O2 — CID 20599896
5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-1,3-dioxane (PubChem CID 20599896) has the molecular formula C30H48F2O2 and a molecular weight of 478.71 g/mol. Its IUPAC name is 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599896 |
| Molecular Formula | C30H48F2O2 |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/CC1CCC(CCC2COC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)OC2)CC1 |
| InChI | InChI=1S/C30H48F2O2/c1-2-3-4-22-5-7-23(8-6-22)9-10-25-20-33-30(34-21-25)28-17-15-27(16-18-28)26-13-11-24(12-14-26)19-29(31)32/h2-3,19,22-28,30H,4-18,20-21H2,1H3/b3-2+ |
| InChIKey | VIVOYGZRSBDSFI-NSCUHMNNSA-N |
| XLogP | 8.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|