C21H32F2O2 — CID 162548124
5-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-2-(4-methylcyclohexyl)-1,3-dioxane (PubChem CID 162548124) has the molecular formula C21H32F2O2 and a molecular weight of 354.48 g/mol. Its IUPAC name is 5-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-2-(4-methylcyclohexyl)-1,3-dioxane.
| Compound Name | 5-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-2-(4-methylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 162548124 |
| Molecular Formula | C21H32F2O2 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 5-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-2-(4-methylcyclohexyl)-1,3-dioxane |
| SMILES | CC1CCC(C2OCC(/C=C/C3CCC(C=C(F)F)CC3)CO2)CC1 |
| InChI | InChI=1S/C21H32F2O2/c1-15-2-10-19(11-3-15)21-24-13-18(14-25-21)9-6-16-4-7-17(8-5-16)12-20(22)23/h6,9,12,15-19,21H,2-5,7-8,10-11,13-14H2,1H3/b9-6+ |
| InChIKey | LKTMDWOZQIAPBI-RMKNXTFCSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|