About 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen
1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen (PubChem CID 158672949) has the molecular formula C16H32F2
and a molecular weight of 262.43 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen |
| PubChem CID | 158672949 |
| Molecular Formula | C16H32F2 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen |
| SMILES | C.CC1CCC(C2CCC(C=C(F)F)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C15H24F2.CH4.2H2/c1-11-2-6-13(7-3-11)14-8-4-12(5-9-14)10-15(16)17;;;/h10-14H,2-9H2,1H3;1H4;2*1H |
| InChIKey | IEEDWZPDLXYIGN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen?
The IUPAC name of 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen (CID 158672949) is 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen.
What is the SMILES notation for 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen?
The canonical SMILES for 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen is C.CC1CCC(C2CCC(C=C(F)F)CC2)CC1.[H][H].[H][H].
What is the InChIKey of 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen?
The InChIKey is IEEDWZPDLXYIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2.CH4.2H2/c1-11-2-6-13(7-3-11)14-8-4-12(5-9-14)10-15(16)17;;;/h10-14H,2-9H2,1H3;1H4;2*1H.
What are the key properties of 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen?
1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen has a molecular weight of 262.43 g/mol, XLogP of 6.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane;methane;molecular hydrogen is sourced from PubChem (CID 158672949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).