About cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane
cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane (PubChem CID 91094465) has the molecular formula C27H46F2
and a molecular weight of 408.66 g/mol. Its IUPAC name is cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane.
Molecular Properties
| Compound Name | cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane |
| PubChem CID | 91094465 |
| Molecular Formula | C27H46F2 |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.36 |
| IUPAC Name | cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane |
| SMILES | C1CCC(C2CCCCC2)CC1.CC1CCC(C2CCC(C=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C15H24F2.C12H22/c1-11-2-6-13(7-3-11)14-8-4-12(5-9-14)10-15(16)17;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h10-14H,2-9H2,1H3;11-12H,1-10H2 |
| InChIKey | NKJMXNHGPAPDQB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane?
The IUPAC name of cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane (CID 91094465) is cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane.
What is the SMILES notation for cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane?
The canonical SMILES for cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane is C1CCC(C2CCCCC2)CC1.CC1CCC(C2CCC(C=C(F)F)CC2)CC1.
What is the InChIKey of cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane?
The InChIKey is NKJMXNHGPAPDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2.C12H22/c1-11-2-6-13(7-3-11)14-8-4-12(5-9-14)10-15(16)17;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h10-14H,2-9H2,1H3;11-12H,1-10H2.
What are the key properties of cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane?
cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane has a molecular weight of 408.66 g/mol, XLogP of 9.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane;1-(2,2-difluoroethenyl)-4-(4-methylcyclohexyl)cyclohexane is sourced from PubChem (CID 91094465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).