C8H12F2 — CID 22182864
2,2-difluoroethenylcyclohexane (PubChem CID 22182864) has the molecular formula C8H12F2 and a molecular weight of 146.18 g/mol. Its IUPAC name is 2,2-difluoroethenylcyclohexane.
| Compound Name | 2,2-difluoroethenylcyclohexane |
|---|---|
| PubChem CID | 22182864 |
| Molecular Formula | C8H12F2 |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2,2-difluoroethenylcyclohexane |
| SMILES | FC(F)=CC1CCCCC1 |
| InChI | InChI=1S/C8H12F2/c9-8(10)6-7-4-2-1-3-5-7/h6-7H,1-5H2 |
| InChIKey | YTGCLAROFHXGAC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |