C10H14F3I — CID 11301569
[(Z)-4,4,4-trifluoro-2-iodobut-1-enyl]cyclohexane (PubChem CID 11301569) has the molecular formula C10H14F3I and a molecular weight of 318.12 g/mol. Its IUPAC name is [(Z)-4,4,4-trifluoro-2-iodobut-1-enyl]cyclohexane.
| Compound Name | [(Z)-4,4,4-trifluoro-2-iodobut-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 11301569 |
| Molecular Formula | C10H14F3I |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | [(Z)-4,4,4-trifluoro-2-iodobut-1-enyl]cyclohexane |
| SMILES | FC(F)(F)C/C(I)=C/C1CCCCC1 |
| InChI | InChI=1S/C10H14F3I/c11-10(12,13)7-9(14)6-8-4-2-1-3-5-8/h6,8H,1-5,7H2/b9-6- |
| InChIKey | GTAIYYJNVNFGTJ-TWGQIWQCSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|