C28H44F2O — CID 20599869
5-(2,2-difluoroethenyl)-2-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]oxane (PubChem CID 20599869) has the molecular formula C28H44F2O and a molecular weight of 434.66 g/mol. Its IUPAC name is 5-(2,2-difluoroethenyl)-2-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]oxane.
| Compound Name | 5-(2,2-difluoroethenyl)-2-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599869 |
| Molecular Formula | C28H44F2O |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 5-(2,2-difluoroethenyl)-2-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]oxane |
| SMILES | C/C=C/C1CCC(C2CCC(C3CCC(C4CCC(C=C(F)F)CO4)CC3)CC2)CC1 |
| InChI | InChI=1S/C28H44F2O/c1-2-3-20-4-7-22(8-5-20)23-9-11-24(12-10-23)25-13-15-26(16-14-25)27-17-6-21(19-31-27)18-28(29)30/h2-3,18,20-27H,4-17,19H2,1H3/b3-2+ |
| InChIKey | BPQJCSGMPYVOQO-NSCUHMNNSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|