C29H46F2O — CID 20599644
2-[4-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]cyclohexyl]-5-ethenyloxane (PubChem CID 20599644) has the molecular formula C29H46F2O and a molecular weight of 448.68 g/mol. Its IUPAC name is 2-[4-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]cyclohexyl]-5-ethenyloxane.
| Compound Name | 2-[4-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]cyclohexyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 20599644 |
| Molecular Formula | C29H46F2O |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | 2-[4-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]cyclohexyl]-5-ethenyloxane |
| SMILES | C=CC1CCC(C2CCC(C3CCC(C4CCC(CCC=C(F)F)CC4)CC3)CC2)OC1 |
| InChI | InChI=1S/C29H46F2O/c1-2-21-8-19-28(32-20-21)27-17-15-26(16-18-27)25-13-11-24(12-14-25)23-9-6-22(7-10-23)4-3-5-29(30)31/h2,5,21-28H,1,3-4,6-20H2 |
| InChIKey | KIXDROAMUVXEGO-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|