C19H31F — CID 140599571
1-[(E)-2-fluoroethenyl]-4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexane (PubChem CID 140599571) has the molecular formula C19H31F and a molecular weight of 278.45 g/mol. Its IUPAC name is 1-[(E)-2-fluoroethenyl]-4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-[(E)-2-fluoroethenyl]-4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 140599571 |
| Molecular Formula | C19H31F |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-[(E)-2-fluoroethenyl]-4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C/CCC1CCC(C2CCC(/C=C/F)CC2)CC1 |
| InChI | InChI=1S/C19H31F/c1-2-3-4-5-16-6-10-18(11-7-16)19-12-8-17(9-13-19)14-15-20/h2-3,14-19H,4-13H2,1H3/b3-2+,15-14+ |
| InChIKey | OSIUQUDAMHSBCZ-UKQKUJQNSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|