C19H30F2 — CID 22011587
1-(2,2-difluoroethenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexane (PubChem CID 22011587) has the molecular formula C19H30F2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexane.
| Compound Name | 1-(2,2-difluoroethenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexane |
|---|---|
| PubChem CID | 22011587 |
| Molecular Formula | C19H30F2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexane |
| SMILES | CCCC1CCC(/C=C/C2CCC(C=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C19H30F2/c1-2-3-15-4-6-16(7-5-15)8-9-17-10-12-18(13-11-17)14-19(20)21/h8-9,14-18H,2-7,10-13H2,1H3/b9-8+ |
| InChIKey | WNCIJDWJOAYIOA-CMDGGOBGSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|