C16H23F3 — CID 139825193
1-ethenyl-4-[4-(1,2,2-trifluoroethenyl)cyclohexyl]cyclohexane (PubChem CID 139825193) has the molecular formula C16H23F3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-ethenyl-4-[4-(1,2,2-trifluoroethenyl)cyclohexyl]cyclohexane.
| Compound Name | 1-ethenyl-4-[4-(1,2,2-trifluoroethenyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 139825193 |
| Molecular Formula | C16H23F3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-ethenyl-4-[4-(1,2,2-trifluoroethenyl)cyclohexyl]cyclohexane |
| SMILES | C=CC1CCC(C2CCC(C(F)=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C16H23F3/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(17)16(18)19/h2,11-14H,1,3-10H2 |
| InChIKey | UOUBCNUXLSEQQB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|