C22H25F5O — CID 162587787
5-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 162587787) has the molecular formula C22H25F5O and a molecular weight of 400.43 g/mol. Its IUPAC name is 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 162587787 |
| Molecular Formula | C22H25F5O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | C=CC1CCC(C2CCC(c3cc(F)c(OC(F)=C(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H25F5O/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-18(23)20(19(24)12-17)28-22(27)21(25)26/h2,11-16H,1,3-10H2 |
| InChIKey | PBHUXZFSKRKFTA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|