C23H30F6OSi — CID 54342369
4-[4-[3,5-difluoro-4-(1,2,2-trifluoroethenoxy)phenyl]cyclohexyl]-1-(4-fluorobutyl)silinane (PubChem CID 54342369) has the molecular formula C23H30F6OSi and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[4-[3,5-difluoro-4-(1,2,2-trifluoroethenoxy)phenyl]cyclohexyl]-1-(4-fluorobutyl)silinane.
| Compound Name | 4-[4-[3,5-difluoro-4-(1,2,2-trifluoroethenoxy)phenyl]cyclohexyl]-1-(4-fluorobutyl)silinane |
|---|---|
| PubChem CID | 54342369 |
| Molecular Formula | C23H30F6OSi |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-[4-[3,5-difluoro-4-(1,2,2-trifluoroethenoxy)phenyl]cyclohexyl]-1-(4-fluorobutyl)silinane |
| SMILES | FCCCC[SiH]1CCC(C2CCC(c3cc(F)c(OC(F)=C(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H30F6OSi/c24-9-1-2-10-31-11-7-17(8-12-31)15-3-5-16(6-4-15)18-13-19(25)21(20(26)14-18)30-23(29)22(27)28/h13-17,31H,1-12H2 |
| InChIKey | TZVSMCOVHIRPBV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|