C23H38F2Si — CID 54554709
4-[3,5-difluoro-4-[(2S)-2-methylbutyl]phenyl]-1-heptylsilinane (PubChem CID 54554709) has the molecular formula C23H38F2Si and a molecular weight of 380.64 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-[(2S)-2-methylbutyl]phenyl]-1-heptylsilinane.
| Compound Name | 4-[3,5-difluoro-4-[(2S)-2-methylbutyl]phenyl]-1-heptylsilinane |
|---|---|
| PubChem CID | 54554709 |
| Molecular Formula | C23H38F2Si |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 4-[3,5-difluoro-4-[(2S)-2-methylbutyl]phenyl]-1-heptylsilinane |
| SMILES | CCCCCCC[SiH]1CCC(c2cc(F)c(C[C@@H](C)CC)c(F)c2)CC1 |
| InChI | InChI=1S/C23H38F2Si/c1-4-6-7-8-9-12-26-13-10-19(11-14-26)20-16-22(24)21(23(25)17-20)15-18(3)5-2/h16-19,26H,4-15H2,1-3H3/t18-,19?,26?/m0/s1 |
| InChIKey | ZMJCUQYZUNAFAF-IXQXIYAPSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|