C27H46Si — CID 54334262
4-[4-[4-[(2S)-2-methylbutyl]phenyl]cyclohexyl]-1-pentylsilinane (PubChem CID 54334262) has the molecular formula C27H46Si and a molecular weight of 398.75 g/mol. Its IUPAC name is 4-[4-[4-[(2S)-2-methylbutyl]phenyl]cyclohexyl]-1-pentylsilinane.
| Compound Name | 4-[4-[4-[(2S)-2-methylbutyl]phenyl]cyclohexyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 54334262 |
| Molecular Formula | C27H46Si |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 4-[4-[4-[(2S)-2-methylbutyl]phenyl]cyclohexyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(C2CCC(c3ccc(C[C@@H](C)CC)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H46Si/c1-4-6-7-18-28-19-16-27(17-20-28)26-14-12-25(13-15-26)24-10-8-23(9-11-24)21-22(3)5-2/h8-11,22,25-28H,4-7,12-21H2,1-3H3/t22-,25?,26?,27?,28?/m0/s1 |
| InChIKey | TUILDUQOIISOMQ-CIPBXAIYSA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|