C24H39N — CID 170248520
N-methyl-4-[4-[4-[(2R)-2-methylbutyl]phenyl]cyclohexyl]cyclohexan-1-amine (PubChem CID 170248520) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is N-methyl-4-[4-[4-[(2R)-2-methylbutyl]phenyl]cyclohexyl]cyclohexan-1-amine.
| Compound Name | N-methyl-4-[4-[4-[(2R)-2-methylbutyl]phenyl]cyclohexyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 170248520 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | N-methyl-4-[4-[4-[(2R)-2-methylbutyl]phenyl]cyclohexyl]cyclohexan-1-amine |
| SMILES | CC[C@@H](C)Cc1ccc(C2CCC(C3CCC(NC)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H39N/c1-4-18(2)17-19-5-7-20(8-6-19)21-9-11-22(12-10-21)23-13-15-24(25-3)16-14-23/h5-8,18,21-25H,4,9-17H2,1-3H3/t18-,21?,22?,23?,24?/m1/s1 |
| InChIKey | YYIBWKFUQAULPF-ZTZVXNSDSA-N |
| XLogP | 6.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |