C23H38 — CID 144529338
ethane;1-ethyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 144529338) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is ethane;1-ethyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | ethane;1-ethyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 144529338 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | ethane;1-ethyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | CC.CCc1ccc(C2CCC(C3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H32.C2H6/c1-3-17-6-10-19(11-7-17)21-14-12-20(13-15-21)18-8-4-16(2)5-9-18;1-2/h6-7,10-11,16,18,20-21H,3-5,8-9,12-15H2,1-2H3;1-2H3 |
| InChIKey | ULDWQYGGASETHG-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |