C20H32F2OSi — CID 54164040
4-[4-(2,2-difluoroethoxy)phenyl]-1-heptylsilinane (PubChem CID 54164040) has the molecular formula C20H32F2OSi and a molecular weight of 354.56 g/mol. Its IUPAC name is 4-[4-(2,2-difluoroethoxy)phenyl]-1-heptylsilinane.
| Compound Name | 4-[4-(2,2-difluoroethoxy)phenyl]-1-heptylsilinane |
|---|---|
| PubChem CID | 54164040 |
| Molecular Formula | C20H32F2OSi |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-[4-(2,2-difluoroethoxy)phenyl]-1-heptylsilinane |
| SMILES | CCCCCCC[SiH]1CCC(c2ccc(OCC(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H32F2OSi/c1-2-3-4-5-6-13-24-14-11-18(12-15-24)17-7-9-19(10-8-17)23-16-20(21)22/h7-10,18,20,24H,2-6,11-16H2,1H3 |
| InChIKey | OQKHPZCQZHXMCA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|