About CID 22373424
CID 22373424 (PubChem CID 22373424) has the molecular formula C24H31F2OSi
and a molecular weight of 401.59 g/mol.
Molecular Properties
| Compound Name | CID 22373424 |
| PubChem CID | 22373424 |
| Molecular Formula | C24H31F2OSi |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(c2ccc(-c3ccc(OCC(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H31F2OSi/c1-2-3-4-15-28-16-13-22(14-17-28)20-7-5-19(6-8-20)21-9-11-23(12-10-21)27-18-24(25)26/h5-12,22,24H,2-4,13-18H2,1H3 |
| InChIKey | QDGDHMUKFMZCCI-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22373424 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22373424?
The IUPAC name of CID 22373424 (CID 22373424) is not available.
What is the SMILES notation for CID 22373424?
The canonical SMILES for CID 22373424 is CCCCC[Si]1CCC(c2ccc(-c3ccc(OCC(F)F)cc3)cc2)CC1.
What is the InChIKey of CID 22373424?
The InChIKey is QDGDHMUKFMZCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31F2OSi/c1-2-3-4-15-28-16-13-22(14-17-28)20-7-5-19(6-8-20)21-9-11-23(12-10-21)27-18-24(25)26/h5-12,22,24H,2-4,13-18H2,1H3.
What are the key properties of CID 22373424?
CID 22373424 has a molecular weight of 401.59 g/mol, XLogP of 7.56, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22373424 is sourced from PubChem (CID 22373424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).