About CID 22924523
CID 22924523 (PubChem CID 22924523) has the molecular formula C22H27F2Si
and a molecular weight of 357.54 g/mol.
Molecular Properties
| Compound Name | CID 22924523 |
| PubChem CID | 22924523 |
| Molecular Formula | C22H27F2Si |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(c2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H27F2Si/c1-2-3-4-13-25-14-11-19(12-15-25)17-5-7-18(8-6-17)20-9-10-21(23)22(24)16-20/h5-10,16,19H,2-4,11-15H2,1H3 |
| InChIKey | HGLVEWFALLPAGC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22924523 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22924523?
The IUPAC name of CID 22924523 (CID 22924523) is not available.
What is the SMILES notation for CID 22924523?
The canonical SMILES for CID 22924523 is CCCCC[Si]1CCC(c2ccc(-c3ccc(F)c(F)c3)cc2)CC1.
What is the InChIKey of CID 22924523?
The InChIKey is HGLVEWFALLPAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2Si/c1-2-3-4-13-25-14-11-19(12-15-25)17-5-7-18(8-6-17)20-9-10-21(23)22(24)16-20/h5-10,16,19H,2-4,11-15H2,1H3.
What are the key properties of CID 22924523?
CID 22924523 has a molecular weight of 357.54 g/mol, XLogP of 7.19, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22924523 is sourced from PubChem (CID 22924523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).