C31H44FSi — CID 19609422
CID 19609422 (PubChem CID 19609422) has the molecular formula C31H44FSi and a molecular weight of 463.78 g/mol.
| Compound Name | CID 19609422 |
|---|---|
| PubChem CID | 19609422 |
| Molecular Formula | C31H44FSi |
| Molecular Weight | 463.78 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(c2ccc(-c3ccc(C4CCC(CCC)CC4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C31H44FSi/c1-3-5-6-20-33-21-18-27(19-22-33)29-16-17-30(31(32)23-29)28-14-12-26(13-15-28)25-10-8-24(7-4-2)9-11-25/h12-17,23-25,27H,3-11,18-22H2,1-2H3 |
| InChIKey | NPOWBEVMJBVWQD-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.78 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|