C29H40FSi — CID 19080554
CID 19080554 (PubChem CID 19080554) has the molecular formula C29H40FSi and a molecular weight of 435.72 g/mol.
| Compound Name | CID 19080554 |
|---|---|
| PubChem CID | 19080554 |
| Molecular Formula | C29H40FSi |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | — |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(C4CC[Si](CCC)CC4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H40FSi/c1-3-5-22-6-8-24(9-7-22)27-14-15-28(29(30)21-27)26-12-10-23(11-13-26)25-16-19-31(18-4-2)20-17-25/h10-15,21-22,24-25H,3-9,16-20H2,1-2H3 |
| InChIKey | ZSJOWUBIPQHVNG-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|