C20H28F2O3 — CID 18659031
2,2-difluoroethyl 4-(4-pentoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 18659031) has the molecular formula C20H28F2O3 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-(4-pentoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | 2,2-difluoroethyl 4-(4-pentoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18659031 |
| Molecular Formula | C20H28F2O3 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2,2-difluoroethyl 4-(4-pentoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCOc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C20H28F2O3/c1-2-3-4-13-24-18-11-9-16(10-12-18)15-5-7-17(8-6-15)20(23)25-14-19(21)22/h9-12,15,17,19H,2-8,13-14H2,1H3 |
| InChIKey | YYSMZTDYHNLPSV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|