C23H34F2O3 — CID 18659029
2,2-difluoroethyl 4-(4-octoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 18659029) has the molecular formula C23H34F2O3 and a molecular weight of 396.52 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-(4-octoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | 2,2-difluoroethyl 4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18659029 |
| Molecular Formula | C23H34F2O3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2,2-difluoroethyl 4-(4-octoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(C2CCC(C(=O)OCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C23H34F2O3/c1-2-3-4-5-6-7-16-27-21-14-12-19(13-15-21)18-8-10-20(11-9-18)23(26)28-17-22(24)25/h12-15,18,20,22H,2-11,16-17H2,1H3 |
| InChIKey | ZXIDFMWYNUQICC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|