C23H27F3O2Si — CID 54356523
(4-fluorophenyl) 2,6-difluoro-4-(1-pentylsilinan-4-yl)benzoate (PubChem CID 54356523) has the molecular formula C23H27F3O2Si and a molecular weight of 420.55 g/mol. Its IUPAC name is (4-fluorophenyl) 2,6-difluoro-4-(1-pentylsilinan-4-yl)benzoate.
| Compound Name | (4-fluorophenyl) 2,6-difluoro-4-(1-pentylsilinan-4-yl)benzoate |
|---|---|
| PubChem CID | 54356523 |
| Molecular Formula | C23H27F3O2Si |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (4-fluorophenyl) 2,6-difluoro-4-(1-pentylsilinan-4-yl)benzoate |
| SMILES | CCCCC[SiH]1CCC(c2cc(F)c(C(=O)Oc3ccc(F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27F3O2Si/c1-2-3-4-11-29-12-9-16(10-13-29)17-14-20(25)22(21(26)15-17)23(27)28-19-7-5-18(24)6-8-19/h5-8,14-16,29H,2-4,9-13H2,1H3 |
| InChIKey | UJMHHQXWSSAWLF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|