C26H27F3O2 — CID 54444939
(4-fluorophenyl) 2,6-difluoro-4-(4-heptylcyclohexa-2,4-dien-1-yl)benzoate (PubChem CID 54444939) has the molecular formula C26H27F3O2 and a molecular weight of 428.49 g/mol. Its IUPAC name is (4-fluorophenyl) 2,6-difluoro-4-(4-heptylcyclohexa-2,4-dien-1-yl)benzoate.
| Compound Name | (4-fluorophenyl) 2,6-difluoro-4-(4-heptylcyclohexa-2,4-dien-1-yl)benzoate |
|---|---|
| PubChem CID | 54444939 |
| Molecular Formula | C26H27F3O2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (4-fluorophenyl) 2,6-difluoro-4-(4-heptylcyclohexa-2,4-dien-1-yl)benzoate |
| SMILES | CCCCCCCC1=CCC(c2cc(F)c(C(=O)Oc3ccc(F)cc3)c(F)c2)C=C1 |
| InChI | InChI=1S/C26H27F3O2/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)20-16-23(28)25(24(29)17-20)26(30)31-22-14-12-21(27)13-15-22/h8-10,12-17,19H,2-7,11H2,1H3 |
| InChIKey | WQVDBAROGUXRCY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|