C21H30O2 — CID 144971657
1-heptoxy-4-[4-(methoxymethyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 144971657) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-heptoxy-4-[4-(methoxymethyl)cyclohexa-2,4-dien-1-yl]benzene.
| Compound Name | 1-heptoxy-4-[4-(methoxymethyl)cyclohexa-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 144971657 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-heptoxy-4-[4-(methoxymethyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | CCCCCCCOc1ccc(C2C=CC(COC)=CC2)cc1 |
| InChI | InChI=1S/C21H30O2/c1-3-4-5-6-7-16-23-21-14-12-20(13-15-21)19-10-8-18(9-11-19)17-22-2/h8-10,12-15,19H,3-7,11,16-17H2,1-2H3 |
| InChIKey | WKAPMFLAZVBLII-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|