C23H26O3S — CID 70877042
4-[2-(4-hexoxyphenyl)-2,3-dihydrothiophen-5-yl]benzoic acid (PubChem CID 70877042) has the molecular formula C23H26O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-[2-(4-hexoxyphenyl)-2,3-dihydrothiophen-5-yl]benzoic acid.
| Compound Name | 4-[2-(4-hexoxyphenyl)-2,3-dihydrothiophen-5-yl]benzoic acid |
|---|---|
| PubChem CID | 70877042 |
| Molecular Formula | C23H26O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[2-(4-hexoxyphenyl)-2,3-dihydrothiophen-5-yl]benzoic acid |
| SMILES | CCCCCCOc1ccc(C2CC=C(c3ccc(C(=O)O)cc3)S2)cc1 |
| InChI | InChI=1S/C23H26O3S/c1-2-3-4-5-16-26-20-12-10-18(11-13-20)22-15-14-21(27-22)17-6-8-19(9-7-17)23(24)25/h6-14,22H,2-5,15-16H2,1H3,(H,24,25) |
| InChIKey | GWLNQKWYNFALDW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|