C29H36O3 — CID 173330353
(4-cyclohexa-2,4-dien-1-ylphenyl) 4-decoxybenzoate (PubChem CID 173330353) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is (4-cyclohexa-2,4-dien-1-ylphenyl) 4-decoxybenzoate.
| Compound Name | (4-cyclohexa-2,4-dien-1-ylphenyl) 4-decoxybenzoate |
|---|---|
| PubChem CID | 173330353 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (4-cyclohexa-2,4-dien-1-ylphenyl) 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C3C=CC=CC3)cc2)cc1 |
| InChI | InChI=1S/C29H36O3/c1-2-3-4-5-6-7-8-12-23-31-27-19-17-26(18-20-27)29(30)32-28-21-15-25(16-22-28)24-13-10-9-11-14-24/h9-11,13,15-22,24H,2-8,12,14,23H2,1H3 |
| InChIKey | JYIXXSPALDZEEB-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|