C34H43F2NO3 — CID 139795123
[6-(4-decoxyphenyl)-3-pyridinyl] 2,6-difluoro-4-hexylbenzoate (PubChem CID 139795123) has the molecular formula C34H43F2NO3 and a molecular weight of 551.72 g/mol. Its IUPAC name is [6-(4-decoxyphenyl)-3-pyridinyl] 2,6-difluoro-4-hexylbenzoate.
| Compound Name | [6-(4-decoxyphenyl)-3-pyridinyl] 2,6-difluoro-4-hexylbenzoate |
|---|---|
| PubChem CID | 139795123 |
| Molecular Formula | C34H43F2NO3 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | [6-(4-decoxyphenyl)-3-pyridinyl] 2,6-difluoro-4-hexylbenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3c(F)cc(CCCCCC)cc3F)cn2)cc1 |
| InChI | InChI=1S/C34H43F2NO3/c1-3-5-7-9-10-11-12-14-22-39-28-18-16-27(17-19-28)32-21-20-29(25-37-32)40-34(38)33-30(35)23-26(24-31(33)36)15-13-8-6-4-2/h16-21,23-25H,3-15,22H2,1-2H3 |
| InChIKey | BRACUHOSHPXAFN-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|