About [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate
[4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate (PubChem CID 19858768) has the molecular formula C26H28FNO2
and a molecular weight of 405.51 g/mol. Its IUPAC name is [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate.
Molecular Properties
| Compound Name | [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate |
| PubChem CID | 19858768 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate |
| SMILES | CCCCCCc1ccc(C(=O)Oc2ccc(-c3ccc(CC)cn3)cc2)c(F)c1 |
| InChI | InChI=1S/C26H28FNO2/c1-3-5-6-7-8-20-9-15-23(24(27)17-20)26(29)30-22-13-11-21(12-14-22)25-16-10-19(4-2)18-28-25/h9-18H,3-8H2,1-2H3 |
| InChIKey | GBNKLHJUEPLLNP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate?
The IUPAC name of [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate (CID 19858768) is [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate.
What is the SMILES notation for [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate?
The canonical SMILES for [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate is CCCCCCc1ccc(C(=O)Oc2ccc(-c3ccc(CC)cn3)cc2)c(F)c1.
What is the InChIKey of [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate?
The InChIKey is GBNKLHJUEPLLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28FNO2/c1-3-5-6-7-8-20-9-15-23(24(27)17-20)26(29)30-22-13-11-21(12-14-22)25-16-10-19(4-2)18-28-25/h9-18H,3-8H2,1-2H3.
What are the key properties of [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate?
[4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate has a molecular weight of 405.51 g/mol, XLogP of 6.79, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-ethyl-2-pyridinyl)phenyl] 2-fluoro-4-hexylbenzoate is sourced from PubChem (CID 19858768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).