C18H17F3O2 — CID 54542932
(4-fluorophenyl) 2,6-difluoro-4-pentylbenzoate (PubChem CID 54542932) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is (4-fluorophenyl) 2,6-difluoro-4-pentylbenzoate.
| Compound Name | (4-fluorophenyl) 2,6-difluoro-4-pentylbenzoate |
|---|---|
| PubChem CID | 54542932 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (4-fluorophenyl) 2,6-difluoro-4-pentylbenzoate |
| SMILES | CCCCCc1cc(F)c(C(=O)Oc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C18H17F3O2/c1-2-3-4-5-12-10-15(20)17(16(21)11-12)18(22)23-14-8-6-13(19)7-9-14/h6-11H,2-5H2,1H3 |
| InChIKey | ZENGVKPOGJWUSF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|