C23H22F2N2O2 — CID 20708965
(4-methylphenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate (PubChem CID 20708965) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is (4-methylphenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate.
| Compound Name | (4-methylphenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 20708965 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (4-methylphenyl) 2,6-difluoro-4-(5-pentylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCc1cnc(-c2cc(F)c(C(=O)Oc3ccc(C)cc3)c(F)c2)nc1 |
| InChI | InChI=1S/C23H22F2N2O2/c1-3-4-5-6-16-13-26-22(27-14-16)17-11-19(24)21(20(25)12-17)23(28)29-18-9-7-15(2)8-10-18/h7-14H,3-6H2,1-2H3 |
| InChIKey | CNFGWXZNBRHZMC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|