C28H29F2NO2 — CID 19005402
(4-cyanophenyl) 2,6-difluoro-4-(4-octylcyclohexa-1,3-dien-1-yl)benzoate (PubChem CID 19005402) has the molecular formula C28H29F2NO2 and a molecular weight of 449.54 g/mol. Its IUPAC name is (4-cyanophenyl) 2,6-difluoro-4-(4-octylcyclohexa-1,3-dien-1-yl)benzoate.
| Compound Name | (4-cyanophenyl) 2,6-difluoro-4-(4-octylcyclohexa-1,3-dien-1-yl)benzoate |
|---|---|
| PubChem CID | 19005402 |
| Molecular Formula | C28H29F2NO2 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (4-cyanophenyl) 2,6-difluoro-4-(4-octylcyclohexa-1,3-dien-1-yl)benzoate |
| SMILES | CCCCCCCCC1=CC=C(c2cc(F)c(C(=O)Oc3ccc(C#N)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H29F2NO2/c1-2-3-4-5-6-7-8-20-9-13-22(14-10-20)23-17-25(29)27(26(30)18-23)28(32)33-24-15-11-21(19-31)12-16-24/h9,11-13,15-18H,2-8,10,14H2,1H3 |
| InChIKey | JFEWHDOZOYGSGF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|