C18H15F2NO3 — CID 139799256
(4-cyanophenyl) 2,6-difluoro-4-(propoxymethyl)benzoate (PubChem CID 139799256) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is (4-cyanophenyl) 2,6-difluoro-4-(propoxymethyl)benzoate.
| Compound Name | (4-cyanophenyl) 2,6-difluoro-4-(propoxymethyl)benzoate |
|---|---|
| PubChem CID | 139799256 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4-cyanophenyl) 2,6-difluoro-4-(propoxymethyl)benzoate |
| SMILES | CCCOCc1cc(F)c(C(=O)Oc2ccc(C#N)cc2)c(F)c1 |
| InChI | InChI=1S/C18H15F2NO3/c1-2-7-23-11-13-8-15(19)17(16(20)9-13)18(22)24-14-5-3-12(10-21)4-6-14/h3-6,8-9H,2,7,11H2,1H3 |
| InChIKey | LWUWBEILJBERML-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|