C17H20F2 — CID 19005447
1,3-difluoro-5-(4-pentylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 19005447) has the molecular formula C17H20F2 and a molecular weight of 262.34 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-pentylcyclohexa-1,3-dien-1-yl)benzene.
| Compound Name | 1,3-difluoro-5-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 19005447 |
| Molecular Formula | C17H20F2 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1,3-difluoro-5-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | CCCCCC1=CC=C(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C17H20F2/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-16(18)12-17(19)11-15/h6,8,10-12H,2-5,7,9H2,1H3 |
| InChIKey | BSCXVZILZBSJGE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|